Initial commit

.gitignore

+*.iml
+build
+.idea
+.gradle
+

README.md

+# Шаблон веб-приложения с кастомным REST API
+
+В приложении приведен пример создания кастомного REST API на Java.
+
+Данное приложение можно разместить в сервере приложений JBoss, который 
+устанавливается вместе с Synergy.
+
+## Сборка
+
+Сборка осуществляется при помощи [Gradle Build Tool](https://gradle.org/)
+
+```bash
+$ ./gradlew war
+```
+
+Собранный `synergy-api-proxy-1.0.war` необходимо поместить 
+в `/opt/synergy/jboss/standalone/deployments`
+
+## Конфигурация
+
+Приложение читает конфигурационный файл `synergy-api-proxy.properties`
+в директории `/opt/synergy/jboss/standalone/configuration/external`.
+
+Параметры конфигурации:
+
+```properties
+# Приведенные ниже значения параметров являются значениями по-умолчанию
+
+# Адрес Synergy для доступа к REST API
+synergy.url=http://127.0.0.1:8080/Synergy
+# Логин пользователя от имени которого будет выполняться запрос к REST API Synergy
+synergy.user.login=1
+# Пароль пользователя от имени которого будет выполняться запрос к REST API Synergy
+synergy.user.password=1
+```
+
+## REST API
+
+Endpoint: `http[s]://host:[port]/sap`
+
+1. Метод получения изображения `/proxy/unsecured/image`
+
+    ```
+        /**
+         * Обертка над методом /rest/api/storage/file/get
+         * Не требует авторизации.
+         * Обращение к REST API Synergy осуществляется от имени пользователя,
+         * указанного в настройках (параметры synergy.user.login и synergy.user.password)
+         *
+         * @param identifier идентификатор файла в хранилище
+         * @return inline изображение. Если запрошенный файл не является изображением, то вернется ошибка.
+         */
+    ```
+    
+    Пример запроса:
+    
+    `http://127.0.0.1:8080/sap/proxy/unsecured/image?identifier=29130a30-42cf-451a-98e8-6f6827d3751b`
\ No newline at end of file

build.gradle

+apply plugin: 'war'
+
+sourceCompatibility = 1.7
+version = '1.0'
+
+task wrapper(type: Wrapper) {
+    gradleVersion = '4.6'
+    distributionUrl = 'http://services.gradle.org/distributions/gradle-4.6-all.zip'
+}
+
+repositories {
+    mavenCentral()
+}
+
+dependencies {
+    providedCompile(group: 'org.slf4j', name: 'slf4j-api', version: '1.6.1', transitive: false)
+    providedCompile(group: 'org.codehaus.jackson', name: 'jackson-core-asl', version: '1.9.2', transitive: false)
+    providedCompile(group: 'org.codehaus.jackson', name: 'jackson-mapper-asl', version: '1.9.2', transitive: false)
+    compile 'org.apache.httpcomponents:httpclient:4.5.1'
+    providedCompile(group: 'org.jboss.resteasy', name: 'resteasy-jaxrs', version: '2.3.3.Final', transitive: false)
+    providedCompile 'org.jboss.spec:jboss-javaee-6.0:3.0.3.Final'
+}
\ No newline at end of file

configuration/external/synergy-api-proxy.properties

+# Приведенные ниже значения параметров являются значениями по-умолчанию
+
+# Адрес Synergy для доступа к REST API
+synergy.url=http://127.0.0.1:8080/Synergy
+# Логин пользователя от имени которого будет выполняться запрос к REST API Synergy
+synergy.user.login=1
+# Пароль пользователя от имени которого будет выполняться запрос к REST API Synergy
+synergy.user.password=1
\ No newline at end of file

gradle/wrapper/gradle-wrapper.properties

+#Mon Apr 16 12:37:30 ALMT 2018
+distributionBase=GRADLE_USER_HOME
+distributionPath=wrapper/dists
+zipStoreBase=GRADLE_USER_HOME
+zipStorePath=wrapper/dists
+distributionUrl=http\://services.gradle.org/distributions/gradle-4.6-all.zip

gradlew

+#!/usr/bin/env bash
+
+##############################################################################
+##
+##  Gradle start up script for UN*X
+##
+##############################################################################
+
+# Add default JVM options here. You can also use JAVA_OPTS and GRADLE_OPTS to pass JVM options to this script.
+DEFAULT_JVM_OPTS=""
+
+APP_NAME="Gradle"
+APP_BASE_NAME=`basename "$0"`
+
+# Use the maximum available, or set MAX_FD != -1 to use that value.
+MAX_FD="maximum"
+
+warn ( ) {
+    echo "$*"
+}
+
+die ( ) {
+    echo
+    echo "$*"
+    echo
+    exit 1
+}
+
+# OS specific support (must be 'true' or 'false').
+cygwin=false
+msys=false
+darwin=false
+case "`uname`" in
+  CYGWIN* )
+    cygwin=true
+    ;;
+  Darwin* )
+    darwin=true
+    ;;
+  MINGW* )
+    msys=true
+    ;;
+esac
+
+# For Cygwin, ensure paths are in UNIX format before anything is touched.
+if $cygwin ; then
+    [ -n "$JAVA_HOME" ] && JAVA_HOME=`cygpath --unix "$JAVA_HOME"`
+fi
+
+# Attempt to set APP_HOME
+# Resolve links: $0 may be a link
+PRG="$0"
+# Need this for relative symlinks.
+while [ -h "$PRG" ] ; do
+    ls=`ls -ld "$PRG"`
+    link=`expr "$ls" : '.*-> \(.*\)$'`
+    if expr "$link" : '/.*' > /dev/null; then
+        PRG="$link"
+    else
+        PRG=`dirname "$PRG"`"/$link"
+    fi
+done
+SAVED="`pwd`"
+cd "`dirname \"$PRG\"`/" >&-
+APP_HOME="`pwd -P`"
+cd "$SAVED" >&-
+
+CLASSPATH=$APP_HOME/gradle/wrapper/gradle-wrapper.jar
+
+# Determine the Java command to use to start the JVM.
+if [ -n "$JAVA_HOME" ] ; then
+    if [ -x "$JAVA_HOME/jre/sh/java" ] ; then
+        # IBM's JDK on AIX uses strange locations for the executables
+        JAVACMD="$JAVA_HOME/jre/sh/java"
+    else
+        JAVACMD="$JAVA_HOME/bin/java"
+    fi
+    if [ ! -x "$JAVACMD" ] ; then
+        die "ERROR: JAVA_HOME is set to an invalid directory: $JAVA_HOME
+
+Please set the JAVA_HOME variable in your environment to match the
+location of your Java installation."
+    fi
+else
+    JAVACMD="java"
+    which java >/dev/null 2>&1 || die "ERROR: JAVA_HOME is not set and no 'java' command could be found in your PATH.
+
+Please set the JAVA_HOME variable in your environment to match the
+location of your Java installation."
+fi
+
+# Increase the maximum file descriptors if we can.
+if [ "$cygwin" = "false" -a "$darwin" = "false" ] ; then
+    MAX_FD_LIMIT=`ulimit -H -n`
+    if [ $? -eq 0 ] ; then
+        if [ "$MAX_FD" = "maximum" -o "$MAX_FD" = "max" ] ; then
+            MAX_FD="$MAX_FD_LIMIT"
+        fi
+        ulimit -n $MAX_FD
+        if [ $? -ne 0 ] ; then
+            warn "Could not set maximum file descriptor limit: $MAX_FD"
+        fi
+    else
+        warn "Could not query maximum file descriptor limit: $MAX_FD_LIMIT"
+    fi
+fi
+
+# For Darwin, add options to specify how the application appears in the dock
+if $darwin; then
+    GRADLE_OPTS="$GRADLE_OPTS \"-Xdock:name=$APP_NAME\" \"-Xdock:icon=$APP_HOME/media/gradle.icns\""
+fi
+
+# For Cygwin, switch paths to Windows format before running java
+if $cygwin ; then
+    APP_HOME=`cygpath --path --mixed "$APP_HOME"`
+    CLASSPATH=`cygpath --path --mixed "$CLASSPATH"`
+
+    # We build the pattern for arguments to be converted via cygpath
+    ROOTDIRSRAW=`find -L / -maxdepth 1 -mindepth 1 -type d 2>/dev/null`
+    SEP=""
+    for dir in $ROOTDIRSRAW ; do
+        ROOTDIRS="$ROOTDIRS$SEP$dir"
+        SEP="|"
+    done
+    OURCYGPATTERN="(^($ROOTDIRS))"
+    # Add a user-defined pattern to the cygpath arguments
+    if [ "$GRADLE_CYGPATTERN" != "" ] ; then
+        OURCYGPATTERN="$OURCYGPATTERN|($GRADLE_CYGPATTERN)"
+    fi
+    # Now convert the arguments - kludge to limit ourselves to /bin/sh
+    i=0
+    for arg in "$@" ; do
+        CHECK=`echo "$arg"|egrep -c "$OURCYGPATTERN" -`
+        CHECK2=`echo "$arg"|egrep -c "^-"`                                 ### Determine if an option
+
+        if [ $CHECK -ne 0 ] && [ $CHECK2 -eq 0 ] ; then                    ### Added a condition
+            eval `echo args$i`=`cygpath --path --ignore --mixed "$arg"`
+        else
+            eval `echo args$i`="\"$arg\""
+        fi
+        i=$((i+1))
+    done
+    case $i in
+        (0) set -- ;;
+        (1) set -- "$args0" ;;
+        (2) set -- "$args0" "$args1" ;;
+        (3) set -- "$args0" "$args1" "$args2" ;;
+        (4) set -- "$args0" "$args1" "$args2" "$args3" ;;
+        (5) set -- "$args0" "$args1" "$args2" "$args3" "$args4" ;;
+        (6) set -- "$args0" "$args1" "$args2" "$args3" "$args4" "$args5" ;;
+        (7) set -- "$args0" "$args1" "$args2" "$args3" "$args4" "$args5" "$args6" ;;
+        (8) set -- "$args0" "$args1" "$args2" "$args3" "$args4" "$args5" "$args6" "$args7" ;;
+        (9) set -- "$args0" "$args1" "$args2" "$args3" "$args4" "$args5" "$args6" "$args7" "$args8" ;;
+    esac
+fi
+
+# Split up the JVM_OPTS And GRADLE_OPTS values into an array, following the shell quoting and substitution rules
+function splitJvmOpts() {
+    JVM_OPTS=("$@")
+}
+eval splitJvmOpts $DEFAULT_JVM_OPTS $JAVA_OPTS $GRADLE_OPTS
+JVM_OPTS[${#JVM_OPTS[*]}]="-Dorg.gradle.appname=$APP_BASE_NAME"
+
+exec "$JAVACMD" "${JVM_OPTS[@]}" -classpath "$CLASSPATH" org.gradle.wrapper.GradleWrapperMain "$@"

gradlew.bat

+@if "%DEBUG%" == "" @echo off
+@rem ##########################################################################
+@rem
+@rem  Gradle startup script for Windows
+@rem
+@rem ##########################################################################
+
+@rem Set local scope for the variables with windows NT shell
+if "%OS%"=="Windows_NT" setlocal
+
+@rem Add default JVM options here. You can also use JAVA_OPTS and GRADLE_OPTS to pass JVM options to this script.
+set DEFAULT_JVM_OPTS=
+
+set DIRNAME=%~dp0
+if "%DIRNAME%" == "" set DIRNAME=.
+set APP_BASE_NAME=%~n0
+set APP_HOME=%DIRNAME%
+
+@rem Find java.exe
+if defined JAVA_HOME goto findJavaFromJavaHome
+
+set JAVA_EXE=java.exe
+%JAVA_EXE% -version >NUL 2>&1
+if "%ERRORLEVEL%" == "0" goto init
+
+echo.
+echo ERROR: JAVA_HOME is not set and no 'java' command could be found in your PATH.
+echo.
+echo Please set the JAVA_HOME variable in your environment to match the
+echo location of your Java installation.
+
+goto fail
+
+:findJavaFromJavaHome
+set JAVA_HOME=%JAVA_HOME:"=%
+set JAVA_EXE=%JAVA_HOME%/bin/java.exe
+
+if exist "%JAVA_EXE%" goto init
+
+echo.
+echo ERROR: JAVA_HOME is set to an invalid directory: %JAVA_HOME%
+echo.
+echo Please set the JAVA_HOME variable in your environment to match the
+echo location of your Java installation.
+
+goto fail
+
+:init
+@rem Get command-line arguments, handling Windowz variants
+
+if not "%OS%" == "Windows_NT" goto win9xME_args
+if "%@eval[2+2]" == "4" goto 4NT_args
+
+:win9xME_args
+@rem Slurp the command line arguments.
+set CMD_LINE_ARGS=
+set _SKIP=2
+
+:win9xME_args_slurp
+if "x%~1" == "x" goto execute
+
+set CMD_LINE_ARGS=%*
+goto execute
+
+:4NT_args
+@rem Get arguments from the 4NT Shell from JP Software
+set CMD_LINE_ARGS=%$
+
+:execute
+@rem Setup the command line
+
+set CLASSPATH=%APP_HOME%\gradle\wrapper\gradle-wrapper.jar
+
+@rem Execute Gradle
+"%JAVA_EXE%" %DEFAULT_JVM_OPTS% %JAVA_OPTS% %GRADLE_OPTS% "-Dorg.gradle.appname=%APP_BASE_NAME%" -classpath "%CLASSPATH%" org.gradle.wrapper.GradleWrapperMain %CMD_LINE_ARGS%
+
+:end
+@rem End local scope for the variables with windows NT shell
+if "%ERRORLEVEL%"=="0" goto mainEnd
+
+:fail
+rem Set variable GRADLE_EXIT_CONSOLE if you need the _script_ return code instead of
+rem the _cmd.exe /c_ return code!
+if  not "" == "%GRADLE_EXIT_CONSOLE%" exit 1
+exit /b 1
+
+:mainEnd
+if "%OS%"=="Windows_NT" endlocal
+
+:omega

settings.gradle

+rootProject.name = 'synergy-api-proxy'
+

src/main/java/kz/arta/ext/sap/db/ClientManager.java

+package kz.arta.ext.sap.db;
+
+import kz.arta.ext.sap.util.ConnectionPool;
+import org.slf4j.Logger;
+import org.slf4j.LoggerFactory;
+
+import javax.naming.NamingException;
+import java.sql.Connection;
+import java.sql.PreparedStatement;
+import java.sql.SQLException;
+
+/**
+ * Created by val
+ * Date: 04.10.2015
+ * Time: 12:49
+ *
+ * Пример класса для работы с СУБД
+ * использует соединение, указанное в @{@link ConnectionPool}
+ */
+public class ClientManager {
+
+    private static final Logger LOGGER = LoggerFactory.getLogger(ClientManager.class);
+
+    public static void log(Object logItem) {
+        Connection con = null;
+        try {
+            con = ConnectionPool.getConnection();
+
+            PreparedStatement st = con.prepareStatement("INSERT INTO log(logged, clientid, hostname, extip, localip) VALUES (CURRENT_TIMESTAMP, ?, ?, ?, ?)");
+
+            st.setString(1, "clientId");
+            st.setString(2, "hostname");
+            st.setString(3, "extip");
+            st.setString(4, "localip");
+
+            st.execute();
+
+        } catch (SQLException | NamingException e) {
+            LOGGER.error("", e);
+        } finally {
+            ConnectionPool.close(con);
+        }
+    }
+}

src/main/java/kz/arta/ext/sap/service/Activator.java

+package kz.arta.ext.sap.service;
+
+import javax.ws.rs.ApplicationPath;
+import javax.ws.rs.core.Application;
+
+/**
+ * Created by val
+ * Date: 04.10.2015
+ * Time: 11:18
+ */
+@ApplicationPath("proxy")
+public class Activator extends Application {
+}

src/main/java/kz/arta/ext/sap/service/SecurityInterceptor.java

+package kz.arta.ext.sap.service;
+
+import org.jboss.resteasy.annotations.interception.Precedence;
+import org.jboss.resteasy.annotations.interception.ServerInterceptor;
+import org.jboss.resteasy.core.Headers;
+import org.jboss.resteasy.core.ResourceMethod;
+import org.jboss.resteasy.core.ServerResponse;
+import org.jboss.resteasy.spi.Failure;
+import org.jboss.resteasy.spi.HttpRequest;
+import org.jboss.resteasy.spi.interception.PreProcessInterceptor;
+
+import javax.servlet.http.HttpServletRequest;
+import javax.servlet.http.HttpServletResponse;
+import javax.ws.rs.WebApplicationException;
+import javax.ws.rs.core.Context;
+import javax.ws.rs.ext.Provider;
+
+/**
+ * Created by val
+ * Date: 17.04.2014
+ * Time: 18:51
+ *
+ * Обработчик доступа к методам REST API
+ */
+@Provider
+@ServerInterceptor
+@Precedence("SECURITY")
+public class SecurityInterceptor implements PreProcessInterceptor {
+
+    private static final ServerResponse ACCESS_DENIED = new ServerResponse("Access allowed only for registered users", 401, new Headers<Object>());
+
+    @Context
+    HttpServletRequest request;
+
+    @Context
+    HttpServletResponse response;
+
+    @Override
+    public ServerResponse preProcess(HttpRequest httpRequest, ResourceMethod resourceMethod) throws Failure, WebApplicationException {
+        return null;
+    }
+}

src/main/java/kz/arta/ext/sap/service/UnsecuredProxyService.java

+package kz.arta.ext.sap.service;
+
+import kz.arta.ext.sap.util.Config;
+import org.apache.commons.codec.binary.Base64;
+import org.apache.http.Header;
+import org.apache.http.HttpEntity;
+import org.apache.http.HttpHeaders;
+import org.apache.http.HttpResponse;
+import org.apache.http.client.methods.HttpGet;
+import org.apache.http.impl.client.CloseableHttpClient;
+import org.apache.http.impl.client.HttpClientBuilder;
+import org.slf4j.Logger;
+import org.slf4j.LoggerFactory;
+
+import javax.enterprise.context.RequestScoped;
+import javax.ws.rs.GET;
+import javax.ws.rs.Path;
+import javax.ws.rs.Produces;
+import javax.ws.rs.QueryParam;
+import javax.ws.rs.core.MediaType;
+import javax.ws.rs.core.Response;
+import java.io.IOException;
+import java.nio.charset.Charset;
+
+/**
+ * Created by val
+ * Date: 04.10.2015
+ * Time: 11:27
+ *
+ * REST сервис с методами, которые не требуют авторизации
+ */
+@Path("/unsecured")
+@RequestScoped
+public class UnsecuredProxyService {
+
+    private static final Logger LOGGER = LoggerFactory.getLogger(UnsecuredProxyService.class);
+
+    @GET
+    @Path("/test")
+    @Produces(MediaType.APPLICATION_JSON + "; charset=utf-8")
+    public String test() {
+        return "{\"status\":\"working\"}";
+    }
+
+    /**
+     * Обертка над методом /rest/api/storage/file/get
+     * Не требует авторизации.
+     * Обращение к REST API Synergy осуществляется от имени пользователя,
+     * указанного в настройках (параметры synergy.user.login и synergy.user.password)
+     *
+     * @param identifier идентификатор файла в хранилище
+     * @return inline изображение. Если запрошенный файл не является изображением, то вернется ошибка.
+     */
+    @GET
+    @Path("/image")
+    public Response getImage(@QueryParam("identifier") String identifier) {
+
+        try {
+
+            String auth = Config.getProperty("synergy.user.login", "1") + ":" + Config.getProperty("synergy.user.password", "1");
+            byte[] encodedAuth = Base64.encodeBase64(
+                    auth.getBytes(Charset.forName("UTF-8")));
+            String authHeader = "Basic " + new String(encodedAuth);
+
+            CloseableHttpClient client = HttpClientBuilder.create().build();
+
+            HttpGet request = new HttpGet(Config.getProperty("synergy.url", "http://127.0.0.1:8080/Synergy") +
+                    "/rest/api/storage/file/get?inline=true&identifier=" + identifier);
+            request.setHeader(HttpHeaders.AUTHORIZATION, authHeader);
+
+            HttpResponse response = client.execute(request);
+            HttpEntity entity = response.getEntity();
+
+            int responseCode = response.getStatusLine().getStatusCode();
+
+            LOGGER.info("Request Url: " + request.getURI());
+            LOGGER.info("Response Code: " + responseCode);
+            LOGGER.info("Content-Type: " + entity.getContentType().getValue());
+
+            if (entity.getContentType().getValue().toLowerCase().startsWith("image/png")) {
+
+                Response.ResponseBuilder builder = Response.ok();
+                builder.entity(entity.getContent());
+
+                for (Header header : response.getAllHeaders()) {
+                    builder.header(header.getName(), header.getValue());
+                }
+
+                return builder.build();
+            } else {
+                return Response.status(Response.Status.BAD_REQUEST).entity("Not an image").build();
+            }
+
+        } catch (IOException e) {
+            LOGGER.error("", e);
+            return Response.serverError().build();
+        }
+
+    }
+
+}

src/main/java/kz/arta/ext/sap/util/Config.java

+package kz.arta.ext.sap.util;
+
+import org.slf4j.Logger;
+import org.slf4j.LoggerFactory;
+
+import java.io.File;
+import java.io.FileInputStream;
+import java.io.IOException;
+import java.io.InputStreamReader;
+import java.net.URL;
+import java.util.*;
+
+/**
+ * Created by val
+ * Date: 24.05.2015
+ * Time: 17:02
+ *
+ * Класс для чтения параметров .properties файла
+ * Указанный кофигурационный файл ищется в папке jboss/standalone/configuration
+ */
+public class Config {
+    private static final Logger LOGGER = LoggerFactory.getLogger(Config.class);
+
+    private static Properties props = new Properties();
+
+    static {
+        File confFile = new File(getConfigDir() + "/external/synergy-api-proxy.properties");
+        if (confFile.exists()) {
+            try {
+                props.load(new InputStreamReader(new FileInputStream(confFile), "UTF8"));
+            } catch (IOException e) {
+                LOGGER.error("Configuration file not found");
+            }
+        }
+    }
+
+    public static URL getResource(String path) {
+        return Config.class.getResource(path);
+    }
+
+    public static String getConfigDir() {
+        return System.getProperty("jboss.server.config.dir");
+    }
+
+    public static String getProperty(String name, String defaultValue) {
+        return props.containsKey(name) ? props.getProperty(name) : defaultValue;
+    }
+
+    public static int getIntProperty(String name, int defaultValue) {
+        if (props.containsKey(name)) {
+            int value = defaultValue;
+            String v = props.getProperty(name);
+            try {
+                value = Integer.parseInt(v);
+            } catch (NumberFormatException e) {
+                LOGGER.error("Invalid type of value '" + v + "' for property '" + name + "'. Integer type required.");
+            }
+            return value;
+        } else
+            return defaultValue;
+    }
+
+    public static double getDoubleProperty(String name, double defaultValue) {
+        if (props.containsKey(name)) {
+            double value = defaultValue;
+            String v = props.getProperty(name);
+            try {
+                value = Double.parseDouble(v);
+            } catch (NumberFormatException e) {
+                LOGGER.error("Invalid type of value '" + v + "' for property '" + name + "'. Double type required.");
+            }
+            return value;
+        } else
+            return defaultValue;
+    }
+
+    public static boolean getBooleanProperty(String name, boolean defaultValue) {
+        if (props.containsKey(name)) {
+            boolean value = defaultValue;
+            String v = props.getProperty(name);
+            try {
+                value = Boolean.parseBoolean(v);
+            } catch (Exception e) {
+                LOGGER.error("Invalid type of value '" + v + "' for property '" + name + "'. Boolean type required.");
+            }
+            return value;
+        }
+        return defaultValue;
+    }
+
+    public static List<String> getPropertyList(String mask, String[] defaultValue) {
+        List<String> list = new ArrayList<String>();
+        for (String property : props.stringPropertyNames()) {
+            if (property.startsWith(mask)) {
+                list.add(property.substring(property.lastIndexOf(".") + 1));
+            }
+        }
+        return list.size() > 0 ? list : Arrays.asList(defaultValue);
+    }
+
+    public static Map<String, String> getPropertyList(String mask) {
+        Map<String, String> map = new HashMap<String, String>();
+        for (String property : props.stringPropertyNames()) {
+            if (property.startsWith(mask)) {
+                map.put(property, props.getProperty(property));
+            }
+        }
+        return map;
+    }
+}

src/main/java/kz/arta/ext/sap/util/ConnectionPool.java

+package kz.arta.ext.sap.util;
+
+import org.slf4j.Logger;
+import org.slf4j.LoggerFactory;
+
+import javax.naming.InitialContext;
+import javax.naming.NamingException;
+import javax.sql.DataSource;
+import java.sql.Connection;
+import java.sql.SQLException;
+
+/**
+ * Created by val
+ * Date: 04.10.2015
+ * Time: 11:13
+ *
+ * Пример класса, который отвечает за работу с пулом соединений
+ */
+public class ConnectionPool {
+
+    private static final Logger LOGGER = LoggerFactory.getLogger(ConnectionPool.class);
+
+    public static Connection getConnection() throws SQLException, NamingException {
+        InitialContext ctx = new InitialContext();
+        DataSource ds = (DataSource) ctx.lookup("java:jboss/datasources/DefineDS");
+        return ds.getConnection();
+    }
+
+    public static void close(Connection con) {
+        if (con != null) {
+            try {
+                con.close();
+            } catch (SQLException e) {
+                LOGGER.error("Unable to close connection", e);
+            }
+        }
+    }
+}

src/main/webapp/WEB-INF/jboss-deployment-structure.xml

+<?xml version="1.0" encoding="UTF-8"?>
+<jboss-deployment-structure>
+    <deployment>
+        <dependencies>
+            <module name="org.codehaus.jackson.jackson-jaxrs"/>
+            <module name="org.codehaus.jackson.jackson-mapper-asl"/>
+        </dependencies>
+    </deployment>
+</jboss-deployment-structure>

src/main/webapp/WEB-INF/jboss-web.xml

+<jboss-web>
+    <context-root>sap</context-root>
+</jboss-web>
\ No newline at end of file

src/main/webapp/WEB-INF/web.xml

+<web-app xmlns="http://java.sun.com/xml/ns/javaee"
+         xmlns:xsi="http://www.w3.org/2001/XMLSchema-instance"
+         xsi:schemaLocation="http://java.sun.com/xml/ns/javaee
+		  http://java.sun.com/xml/ns/javaee/web-app_3_0.xsd"
+         version="3.0">
+
+</web-app>
\ No newline at end of file